C16H19Cl3N4OS — CID 19399258
1-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3-ethoxypropyl)thiourea (PubChem CID 19399258) has the molecular formula C16H19Cl3N4OS and a molecular weight of 421.78 g/mol. Its IUPAC name is 1-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 19399258 |
| Molecular Formula | C16H19Cl3N4OS |
| Molecular Weight | 421.78 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 1-[4-chloro-1-[(3,4-dichlorophenyl)methyl]pyrazol-3-yl]-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1nn(Cc2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C16H19Cl3N4OS/c1-2-24-7-3-6-20-16(25)21-15-14(19)10-23(22-15)9-11-4-5-12(17)13(18)8-11/h4-5,8,10H,2-3,6-7,9H2,1H3,(H2,20,21,22,25) |
| InChIKey | HBPQIFHLAWQTIB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.78 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|