C16H21BrN4OS — CID 17263519
1-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-(3-methoxypropyl)thiourea (PubChem CID 17263519) has the molecular formula C16H21BrN4OS and a molecular weight of 397.34 g/mol. Its IUPAC name is 1-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 17263519 |
| Molecular Formula | C16H21BrN4OS |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 1-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)Nc1nn(Cc2ccc(C)cc2)cc1Br |
| InChI | InChI=1S/C16H21BrN4OS/c1-12-4-6-13(7-5-12)10-21-11-14(17)15(20-21)19-16(23)18-8-3-9-22-2/h4-7,11H,3,8-10H2,1-2H3,(H2,18,19,20,23) |
| InChIKey | LWPVWYQAZDVUEF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|