C19H16BrF3N4S — CID 17376054
1-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 17376054) has the molecular formula C19H16BrF3N4S and a molecular weight of 469.33 g/mol. Its IUPAC name is 1-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17376054 |
| Molecular Formula | C19H16BrF3N4S |
| Molecular Weight | 469.33 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 1-[4-bromo-1-[(4-methylphenyl)methyl]pyrazol-3-yl]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1ccc(Cn2cc(Br)c(NC(=S)Nc3ccccc3C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H16BrF3N4S/c1-12-6-8-13(9-7-12)10-27-11-15(20)17(26-27)25-18(28)24-16-5-3-2-4-14(16)19(21,22)23/h2-9,11H,10H2,1H3,(H2,24,25,26,28) |
| InChIKey | CBKBAGGRQPJDJL-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.33 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|