C19H21Br2ClN6S — CID 19573118
1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]thiourea (PubChem CID 19573118) has the molecular formula C19H21Br2ClN6S and a molecular weight of 560.75 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]thiourea.
| Compound Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 19573118 |
| Molecular Formula | C19H21Br2ClN6S |
| Molecular Weight | 560.75 g/mol |
| Exact Mass | 557.96 |
| IUPAC Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[3-(4-bromo-3,5-dimethylpyrazol-1-yl)propyl]thiourea |
| SMILES | Cc1nn(CCCNC(=S)Nc2nn(Cc3ccccc3Cl)cc2Br)c(C)c1Br |
| InChI | InChI=1S/C19H21Br2ClN6S/c1-12-17(21)13(2)28(25-12)9-5-8-23-19(29)24-18-15(20)11-27(26-18)10-14-6-3-4-7-16(14)22/h3-4,6-7,11H,5,8-10H2,1-2H3,(H2,23,24,26,29) |
| InChIKey | CVMCQZKHJUXJAD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.75 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|