C21H21BrClF3N6S — CID 19334348
1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea (PubChem CID 19334348) has the molecular formula C21H21BrClF3N6S and a molecular weight of 561.86 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea.
| Compound Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 19334348 |
| Molecular Formula | C21H21BrClF3N6S |
| Molecular Weight | 561.86 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]thiourea |
| SMILES | FC(F)(F)c1cc(C2CC2)n(CCCNC(=S)Nc2nn(Cc3ccccc3Cl)cc2Br)n1 |
| InChI | InChI=1S/C21H21BrClF3N6S/c22-15-12-31(11-14-4-1-2-5-16(14)23)30-19(15)28-20(33)27-8-3-9-32-17(13-6-7-13)10-18(29-32)21(24,25)26/h1-2,4-5,10,12-13H,3,6-9,11H2,(H2,27,28,30,33) |
| InChIKey | KLMAZVILTXQZEC-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.86 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|