C14H21F3N4OS — CID 19334347
1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(2-methoxyethyl)thiourea (PubChem CID 19334347) has the molecular formula C14H21F3N4OS and a molecular weight of 350.41 g/mol. Its IUPAC name is 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 19334347 |
| Molecular Formula | C14H21F3N4OS |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NCCCn1nc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C14H21F3N4OS/c1-22-8-6-19-13(23)18-5-2-7-21-11(10-3-4-10)9-12(20-21)14(15,16)17/h9-10H,2-8H2,1H3,(H2,18,19,23) |
| InChIKey | WUEILTMPGSFXKB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|