C19H23F3N4S — CID 17300729
1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[(4-methylphenyl)methyl]thiourea (PubChem CID 17300729) has the molecular formula C19H23F3N4S and a molecular weight of 396.48 g/mol. Its IUPAC name is 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[(4-methylphenyl)methyl]thiourea.
| Compound Name | 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[(4-methylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 17300729 |
| Molecular Formula | C19H23F3N4S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[(4-methylphenyl)methyl]thiourea |
| SMILES | Cc1ccc(CNC(=S)NCCCn2nc(C(F)(F)F)cc2C2CC2)cc1 |
| InChI | InChI=1S/C19H23F3N4S/c1-13-3-5-14(6-4-13)12-24-18(27)23-9-2-10-26-16(15-7-8-15)11-17(25-26)19(20,21)22/h3-6,11,15H,2,7-10,12H2,1H3,(H2,23,24,27) |
| InChIKey | LPPPCWIYUYQPAA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|