C18H20ClF3N4S — CID 19334424
1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-methylphenyl)thiourea (PubChem CID 19334424) has the molecular formula C18H20ClF3N4S and a molecular weight of 416.90 g/mol. Its IUPAC name is 1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 19334424 |
| Molecular Formula | C18H20ClF3N4S |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NCCCn2nc(C(F)(F)F)c(Cl)c2C2CC2)cc1 |
| InChI | InChI=1S/C18H20ClF3N4S/c1-11-3-7-13(8-4-11)24-17(27)23-9-2-10-26-15(12-5-6-12)14(19)16(25-26)18(20,21)22/h3-4,7-8,12H,2,5-6,9-10H2,1H3,(H2,23,24,27) |
| InChIKey | RXVWHALCSUDILJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|