C19H22ClF3N4S — CID 19334453
1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-ethylphenyl)thiourea (PubChem CID 19334453) has the molecular formula C19H22ClF3N4S and a molecular weight of 430.93 g/mol. Its IUPAC name is 1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-ethylphenyl)thiourea.
| Compound Name | 1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 19334453 |
| Molecular Formula | C19H22ClF3N4S |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(4-ethylphenyl)thiourea |
| SMILES | CCc1ccc(NC(=S)NCCCn2nc(C(F)(F)F)c(Cl)c2C2CC2)cc1 |
| InChI | InChI=1S/C19H22ClF3N4S/c1-2-12-4-8-14(9-5-12)25-18(28)24-10-3-11-27-16(13-6-7-13)15(20)17(26-27)19(21,22)23/h4-5,8-9,13H,2-3,6-7,10-11H2,1H3,(H2,24,25,28) |
| InChIKey | ZZVBDFXFSXEHDQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|