C23H24Cl3F3N6S — CID 19334461
1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19334461) has the molecular formula C23H24Cl3F3N6S and a molecular weight of 579.91 g/mol. Its IUPAC name is 1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19334461 |
| Molecular Formula | C23H24Cl3F3N6S |
| Molecular Weight | 579.91 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | 1-[3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2Cl)c(C)c1NC(=S)NCCCn1nc(C(F)(F)F)c(Cl)c1C1CC1 |
| InChI | InChI=1S/C23H24Cl3F3N6S/c1-12-19(13(2)35(32-12)11-15-6-7-16(24)10-17(15)25)31-22(36)30-8-3-9-34-20(14-4-5-14)18(26)21(33-34)23(27,28)29/h6-7,10,14H,3-5,8-9,11H2,1-2H3,(H2,30,31,36) |
| InChIKey | UYVHYTVYSRIEEM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.91 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|