C20H29ClFN5S — CID 19344388
1-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(diethylamino)propyl]thiourea (PubChem CID 19344388) has the molecular formula C20H29ClFN5S and a molecular weight of 426.01 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(diethylamino)propyl]thiourea.
| Compound Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(diethylamino)propyl]thiourea |
|---|---|
| PubChem CID | 19344388 |
| Molecular Formula | C20H29ClFN5S |
| Molecular Weight | 426.01 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-[3-(diethylamino)propyl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)Nc1c(C)nn(Cc2ccc(F)cc2Cl)c1C |
| InChI | InChI=1S/C20H29ClFN5S/c1-5-26(6-2)11-7-10-23-20(28)24-19-14(3)25-27(15(19)4)13-16-8-9-17(22)12-18(16)21/h8-9,12H,5-7,10-11,13H2,1-4H3,(H2,23,24,28) |
| InChIKey | CGKFZNJFWSCTRK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.01 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|