C21H25Cl3N6S — CID 19334156
1-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea (PubChem CID 19334156) has the molecular formula C21H25Cl3N6S and a molecular weight of 499.90 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19334156 |
| Molecular Formula | C21H25Cl3N6S |
| Molecular Weight | 499.90 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylpyrazol-1-yl)propyl]-3-[1-[(2,4-dichlorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]thiourea |
| SMILES | Cc1nn(CCCNC(=S)Nc2c(C)nn(Cc3ccc(Cl)cc3Cl)c2C)c(C)c1Cl |
| InChI | InChI=1S/C21H25Cl3N6S/c1-12-19(24)14(3)29(27-12)9-5-8-25-21(31)26-20-13(2)28-30(15(20)4)11-16-6-7-17(22)10-18(16)23/h6-7,10H,5,8-9,11H2,1-4H3,(H2,25,26,31) |
| InChIKey | JYFIVCVSITYGIL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.90 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|