C18H20ClFN6S — CID 19344440
1-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,5-dimethylpyrazol-4-yl)thiourea (PubChem CID 19344440) has the molecular formula C18H20ClFN6S and a molecular weight of 406.92 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,5-dimethylpyrazol-4-yl)thiourea.
| Compound Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,5-dimethylpyrazol-4-yl)thiourea |
|---|---|
| PubChem CID | 19344440 |
| Molecular Formula | C18H20ClFN6S |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(1,5-dimethylpyrazol-4-yl)thiourea |
| SMILES | Cc1nn(Cc2ccc(F)cc2Cl)c(C)c1NC(=S)Nc1cnn(C)c1C |
| InChI | InChI=1S/C18H20ClFN6S/c1-10-17(23-18(27)22-16-8-21-25(4)11(16)2)12(3)26(24-10)9-13-5-6-14(20)7-15(13)19/h5-8H,9H2,1-4H3,(H2,22,23,27) |
| InChIKey | KUFQDERPTNKBDF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|