C17H16ClFN6O3 — CID 19478466
N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-1-methyl-4-nitropyrazole-5-carboxamide (PubChem CID 19478466) has the molecular formula C17H16ClFN6O3 and a molecular weight of 406.81 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-1-methyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-1-methyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19478466 |
| Molecular Formula | C17H16ClFN6O3 |
| Molecular Weight | 406.81 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-1-methyl-4-nitropyrazole-5-carboxamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2Cl)c(C)c1NC(=O)c1c([N+](=O)[O-])cnn1C |
| InChI | InChI=1S/C17H16ClFN6O3/c1-9-15(21-17(26)16-14(25(27)28)7-20-23(16)3)10(2)24(22-9)8-11-4-5-12(19)6-13(11)18/h4-7H,8H2,1-3H3,(H,21,26) |
| InChIKey | KDWKNOIWTIIUAP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|