C18H17ClFN7O5 — CID 19530017
N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 19530017) has the molecular formula C18H17ClFN7O5 and a molecular weight of 465.83 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19530017 |
| Molecular Formula | C18H17ClFN7O5 |
| Molecular Weight | 465.83 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2Cl)c(C)c1NC(=O)Cn1nc([N+](=O)[O-])c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C18H17ClFN7O5/c1-9-16(10(2)24(22-9)7-12-4-5-13(20)6-14(12)19)21-15(28)8-25-11(3)17(26(29)30)18(23-25)27(31)32/h4-6H,7-8H2,1-3H3,(H,21,28) |
| InChIKey | FLMCAOYKHGLQEF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|