C19H20ClFN6O3 — CID 19541874
N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(5-methyl-3-nitropyrazol-1-yl)propanamide (PubChem CID 19541874) has the molecular formula C19H20ClFN6O3 and a molecular weight of 434.86 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(5-methyl-3-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(5-methyl-3-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19541874 |
| Molecular Formula | C19H20ClFN6O3 |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethylpyrazol-4-yl]-3-(5-methyl-3-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2Cl)c(C)c1NC(=O)CCn1nc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C19H20ClFN6O3/c1-11-8-17(27(29)30)24-25(11)7-6-18(28)22-19-12(2)23-26(13(19)3)10-14-4-5-15(21)9-16(14)20/h4-5,8-9H,6-7,10H2,1-3H3,(H,22,28) |
| InChIKey | VCDNGBDPIYBBMQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|