C15H15ClF4N4S — CID 17381041
1-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(2-fluorophenyl)thiourea (PubChem CID 17381041) has the molecular formula C15H15ClF4N4S and a molecular weight of 394.83 g/mol. Its IUPAC name is 1-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 17381041 |
| Molecular Formula | C15H15ClF4N4S |
| Molecular Weight | 394.83 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-(2-fluorophenyl)thiourea |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CCCNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C15H15ClF4N4S/c1-9-12(16)13(15(18,19)20)23-24(9)8-4-7-21-14(25)22-11-6-3-2-5-10(11)17/h2-3,5-6H,4,7-8H2,1H3,(H2,21,22,25) |
| InChIKey | INXMQMHHRCDOHA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.83 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|