C12H17ClF3N3O — CID 19326180
N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]butanamide (PubChem CID 19326180) has the molecular formula C12H17ClF3N3O and a molecular weight of 311.74 g/mol. Its IUPAC name is N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]butanamide.
| Compound Name | N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 19326180 |
| Molecular Formula | C12H17ClF3N3O |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]butanamide |
| SMILES | CCCC(=O)NCCCn1nc(C(F)(F)F)c(Cl)c1C |
| InChI | InChI=1S/C12H17ClF3N3O/c1-3-5-9(20)17-6-4-7-19-8(2)10(13)11(18-19)12(14,15)16/h3-7H2,1-2H3,(H,17,20) |
| InChIKey | OLRCBJUCKHPTLN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|