C12H14Cl2F3N3O2 — CID 19554162
4-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoylamino]butanoyl chloride (PubChem CID 19554162) has the molecular formula C12H14Cl2F3N3O2 and a molecular weight of 360.16 g/mol. Its IUPAC name is 4-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoylamino]butanoyl chloride.
| Compound Name | 4-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoylamino]butanoyl chloride |
|---|---|
| PubChem CID | 19554162 |
| Molecular Formula | C12H14Cl2F3N3O2 |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 4-[3-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]propanoylamino]butanoyl chloride |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CCC(=O)NCCCC(=O)Cl |
| InChI | InChI=1S/C12H14Cl2F3N3O2/c1-7-10(14)11(12(15,16)17)19-20(7)6-4-9(22)18-5-2-3-8(13)21/h2-6H2,1H3,(H,18,22) |
| InChIKey | NWFYFLGQOHGKJE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|