C12H17ClF3N3O2 — CID 19523534
2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-ethoxypropyl)acetamide (PubChem CID 19523534) has the molecular formula C12H17ClF3N3O2 and a molecular weight of 327.73 g/mol. Its IUPAC name is 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-ethoxypropyl)acetamide.
| Compound Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-ethoxypropyl)acetamide |
|---|---|
| PubChem CID | 19523534 |
| Molecular Formula | C12H17ClF3N3O2 |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(3-ethoxypropyl)acetamide |
| SMILES | CCOCCCNC(=O)Cn1nc(C(F)(F)F)c(Cl)c1C |
| InChI | InChI=1S/C12H17ClF3N3O2/c1-3-21-6-4-5-17-9(20)7-19-8(2)10(13)11(18-19)12(14,15)16/h3-7H2,1-2H3,(H,17,20) |
| InChIKey | LCVDSJWFHDWNQN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|