C11H17F3N4O — CID 162583049
N-(3-aminopropyl)-2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 162583049) has the molecular formula C11H17F3N4O and a molecular weight of 278.28 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-(3-aminopropyl)-2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 162583049 |
| Molecular Formula | C11H17F3N4O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N-(3-aminopropyl)-2-[4,5-dimethyl-3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | Cc1c(C(F)(F)F)nn(CC(=O)NCCCN)c1C |
| InChI | InChI=1S/C11H17F3N4O/c1-7-8(2)18(17-10(7)11(12,13)14)6-9(19)16-5-3-4-15/h3-6,15H2,1-2H3,(H,16,19) |
| InChIKey | YADUKHGTTCVSIU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|