C12H20N4O4 — CID 19515867
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(3-ethoxypropyl)acetamide (PubChem CID 19515867) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(3-ethoxypropyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(3-ethoxypropyl)acetamide |
|---|---|
| PubChem CID | 19515867 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(3-ethoxypropyl)acetamide |
| SMILES | CCOCCCNC(=O)Cn1nc(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H20N4O4/c1-4-20-7-5-6-13-11(17)8-15-10(3)12(16(18)19)9(2)14-15/h4-8H2,1-3H3,(H,13,17) |
| InChIKey | CSXPOXDXRLQNSU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|