C17H20N6O3 — CID 51215395
N-[3-(benzimidazol-1-yl)propyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 51215395) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 51215395 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)NCCCn2cnc3ccccc32)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N6O3/c1-12-17(23(25)26)13(2)22(20-12)10-16(24)18-8-5-9-21-11-19-14-6-3-4-7-15(14)21/h3-4,6-7,11H,5,8-10H2,1-2H3,(H,18,24) |
| InChIKey | IUVCWOADYSDRAK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|