C10H16N4O4 — CID 43390149
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(3-hydroxypropyl)acetamide (PubChem CID 43390149) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 43390149 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(3-hydroxypropyl)acetamide |
| SMILES | Cc1nn(CC(=O)NCCCO)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N4O4/c1-7-10(14(17)18)8(2)13(12-7)6-9(16)11-4-3-5-15/h15H,3-6H2,1-2H3,(H,11,16) |
| InChIKey | WBSDHFAWRPMNTN-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|