C13H22N4O4 — CID 103770858
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-hydroxy-4-methylpentyl)acetamide (PubChem CID 103770858) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-hydroxy-4-methylpentyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-hydroxy-4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 103770858 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-(2-hydroxy-4-methylpentyl)acetamide |
| SMILES | Cc1nn(CC(=O)NCC(O)CC(C)C)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H22N4O4/c1-8(2)5-11(18)6-14-12(19)7-16-10(4)13(17(20)21)9(3)15-16/h8,11,18H,5-7H2,1-4H3,(H,14,19) |
| InChIKey | PRSLWJHEYBTMQI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|