C18H23N5O4 — CID 51332852
N-[4-[[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]methyl]phenyl]-2-methylpropanamide (PubChem CID 51332852) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[4-[[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]methyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]methyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 51332852 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[4-[[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]methyl]phenyl]-2-methylpropanamide |
| SMILES | Cc1nn(CC(=O)NCc2ccc(NC(=O)C(C)C)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N5O4/c1-11(2)18(25)20-15-7-5-14(6-8-15)9-19-16(24)10-22-13(4)17(23(26)27)12(3)21-22/h5-8,11H,9-10H2,1-4H3,(H,19,24)(H,20,25) |
| InChIKey | RXRZDVYNDORCHB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|