C17H19FN4O5 — CID 8852231
[(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 8852231) has the molecular formula C17H19FN4O5 and a molecular weight of 378.36 g/mol. Its IUPAC name is [(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 8852231 |
| Molecular Formula | C17H19FN4O5 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [(2R)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)O[C@H](C)C(=O)NCc2ccc(F)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19FN4O5/c1-10-16(22(25)26)11(2)21(20-10)9-15(23)27-12(3)17(24)19-8-13-4-6-14(18)7-5-13/h4-7,12H,8-9H2,1-3H3,(H,19,24)/t12-/m1/s1 |
| InChIKey | CSFITKSDSRLBNW-GFCCVEGCSA-N |
| XLogP | 1.80 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|