C15H16FN3O5 — CID 7869225
2-(4-fluorophenoxy)ethyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 7869225) has the molecular formula C15H16FN3O5 and a molecular weight of 337.31 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 7869225 |
| Molecular Formula | C15H16FN3O5 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)OCCOc2ccc(F)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16FN3O5/c1-10-15(19(21)22)11(2)18(17-10)9-14(20)24-8-7-23-13-5-3-12(16)4-6-13/h3-6H,7-9H2,1-2H3 |
| InChIKey | XAIRGMJKANQZST-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|