C17H21N3O6 — CID 7869262
2-(4-ethoxyphenoxy)ethyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 7869262) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 7869262 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | CCOc1ccc(OCCOC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C17H21N3O6/c1-4-24-14-5-7-15(8-6-14)25-9-10-26-16(21)11-19-13(3)17(20(22)23)12(2)18-19/h5-8H,4,9-11H2,1-3H3 |
| InChIKey | QNENGERJACUMEE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|