C16H17N3O6 — CID 7869432
methyl 4-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]benzoate (PubChem CID 7869432) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is methyl 4-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 7869432 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | methyl 4-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C16H17N3O6/c1-10-15(19(22)23)11(2)18(17-10)8-14(20)25-9-12-4-6-13(7-5-12)16(21)24-3/h4-7H,8-9H2,1-3H3 |
| InChIKey | JLIQYLDJUMLJOH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 113.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|