C17H19N3O5 — CID 4786150
(4-oxo-4-phenylbutyl) 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 4786150) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is (4-oxo-4-phenylbutyl) 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | (4-oxo-4-phenylbutyl) 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 4786150 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (4-oxo-4-phenylbutyl) 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)OCCCC(=O)c2ccccc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19N3O5/c1-12-17(20(23)24)13(2)19(18-12)11-16(22)25-10-6-9-15(21)14-7-4-3-5-8-14/h3-5,7-8H,6,9-11H2,1-2H3 |
| InChIKey | CKXALBVKKZWZMJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|