C18H22N4O5 — CID 7869523
[2-oxo-2-(3-phenylpropylamino)ethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 7869523) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 7869523 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | Cc1nn(CC(=O)OCC(=O)NCCCc2ccccc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N4O5/c1-13-18(22(25)26)14(2)21(20-13)11-17(24)27-12-16(23)19-10-6-9-15-7-4-3-5-8-15/h3-5,7-8H,6,9-12H2,1-2H3,(H,19,23) |
| InChIKey | MOOISWOELVVJRP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|