C20H18N4O6 — CID 9063853
(4-nitrophenyl)methyl 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate (PubChem CID 9063853) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate.
| Compound Name | (4-nitrophenyl)methyl 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 9063853 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate |
| SMILES | Cc1nn(Cc2ccc(C(=O)OCc3ccc([N+](=O)[O-])cc3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18N4O6/c1-13-19(24(28)29)14(2)22(21-13)11-15-3-7-17(8-4-15)20(25)30-12-16-5-9-18(10-6-16)23(26)27/h3-10H,11-12H2,1-2H3 |
| InChIKey | NVVPXRRZUWVMGU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 130.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|