C21H21N3O4 — CID 50888368
(4-nitrophenyl)methyl 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)benzoate (PubChem CID 50888368) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)benzoate.
| Compound Name | (4-nitrophenyl)methyl 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 50888368 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (4-nitrophenyl)methyl 4-(4-ethyl-3,5-dimethylpyrazol-1-yl)benzoate |
| SMILES | CCc1c(C)nn(-c2ccc(C(=O)OCc3ccc([N+](=O)[O-])cc3)cc2)c1C |
| InChI | InChI=1S/C21H21N3O4/c1-4-20-14(2)22-23(15(20)3)18-11-7-17(8-12-18)21(25)28-13-16-5-9-19(10-6-16)24(26)27/h5-12H,4,13H2,1-3H3 |
| InChIKey | ITTUXFHQXXHRMK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|