C20H14ClN3O4S — CID 2410197
(4-nitrophenyl)methyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 2410197) has the molecular formula C20H14ClN3O4S and a molecular weight of 427.87 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 2410197 |
| Molecular Formula | C20H14ClN3O4S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | (4-nitrophenyl)methyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c2sc(C(=O)OCc3ccc([N+](=O)[O-])cc3)cc12 |
| InChI | InChI=1S/C20H14ClN3O4S/c1-12-17-10-18(20(25)28-11-13-2-6-16(7-3-13)24(26)27)29-19(17)23(22-12)15-8-4-14(21)5-9-15/h2-10H,11H2,1H3 |
| InChIKey | BKJMEIMRRGKBTR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|