C22H19ClN2O2S — CID 2538375
3-phenylpropyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 2538375) has the molecular formula C22H19ClN2O2S and a molecular weight of 410.93 g/mol. Its IUPAC name is 3-phenylpropyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | 3-phenylpropyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 2538375 |
| Molecular Formula | C22H19ClN2O2S |
| Molecular Weight | 410.93 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-phenylpropyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c2sc(C(=O)OCCCc3ccccc3)cc12 |
| InChI | InChI=1S/C22H19ClN2O2S/c1-15-19-14-20(22(26)27-13-5-8-16-6-3-2-4-7-16)28-21(19)25(24-15)18-11-9-17(23)10-12-18/h2-4,6-7,9-12,14H,5,8,13H2,1H3 |
| InChIKey | AWYGNSNZOUZZBT-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.93 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|