C21H16ClFN2O3S — CID 5152713
2-(2-fluorophenoxy)ethyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 5152713) has the molecular formula C21H16ClFN2O3S and a molecular weight of 430.89 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 5152713 |
| Molecular Formula | C21H16ClFN2O3S |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 1-(4-chlorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c2sc(C(=O)OCCOc3ccccc3F)cc12 |
| InChI | InChI=1S/C21H16ClFN2O3S/c1-13-16-12-19(21(26)28-11-10-27-18-5-3-2-4-17(18)23)29-20(16)25(24-13)15-8-6-14(22)7-9-15/h2-9,12H,10-11H2,1H3 |
| InChIKey | QXZSHWOQODXALF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|