C16H16N4O4 — CID 9063956
[(1R)-1-cyanoethyl] 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate (PubChem CID 9063956) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate.
| Compound Name | [(1R)-1-cyanoethyl] 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 9063956 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(1R)-1-cyanoethyl] 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate |
| SMILES | Cc1nn(Cc2ccc(C(=O)O[C@H](C)C#N)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N4O4/c1-10(8-17)24-16(21)14-6-4-13(5-7-14)9-19-12(3)15(20(22)23)11(2)18-19/h4-7,10H,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | GTJOHIPVEHNNBH-SNVBAGLBSA-N |
| XLogP | 2.53 |
| TPSA | 111.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|