C21H26N4O5 — CID 9063917
[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate (PubChem CID 9063917) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate.
| Compound Name | [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 9063917 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoate |
| SMILES | Cc1nn(Cc2ccc(C(=O)OCC(=O)N3CCCC[C@@H]3C)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N4O5/c1-14-6-4-5-11-23(14)19(26)13-30-21(27)18-9-7-17(8-10-18)12-24-16(3)20(25(28)29)15(2)22-24/h7-10,14H,4-6,11-13H2,1-3H3/t14-/m0/s1 |
| InChIKey | XLVUGTFJCXZEBI-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|