C15H17ClN2O5 — CID 2622112
[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-chloro-3-nitrobenzoate (PubChem CID 2622112) has the molecular formula C15H17ClN2O5 and a molecular weight of 340.76 g/mol. Its IUPAC name is [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 2622112 |
| Molecular Formula | C15H17ClN2O5 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | [2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl] 4-chloro-3-nitrobenzoate |
| SMILES | C[C@H]1CCCCN1C(=O)COC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17ClN2O5/c1-10-4-2-3-7-17(10)14(19)9-23-15(20)11-5-6-12(16)13(8-11)18(21)22/h5-6,8,10H,2-4,7,9H2,1H3/t10-/m0/s1 |
| InChIKey | GEHONDXTRVISBQ-JTQLQIEISA-N |
| XLogP | 2.81 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|