C16H18ClN3O7 — CID 7764962
ethyl 4-[2-(4-chloro-3-nitrobenzoyl)oxyacetyl]piperazine-1-carboxylate (PubChem CID 7764962) has the molecular formula C16H18ClN3O7 and a molecular weight of 399.79 g/mol. Its IUPAC name is ethyl 4-[2-(4-chloro-3-nitrobenzoyl)oxyacetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(4-chloro-3-nitrobenzoyl)oxyacetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 7764962 |
| Molecular Formula | C16H18ClN3O7 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | ethyl 4-[2-(4-chloro-3-nitrobenzoyl)oxyacetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)COC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C16H18ClN3O7/c1-2-26-16(23)19-7-5-18(6-8-19)14(21)10-27-15(22)11-3-4-12(17)13(9-11)20(24)25/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | CCVNOFFIAXLQCG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|