C15H18ClN3O4 — CID 7968028
[2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 7968028) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is [2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7968028 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | CC(=O)N1CCN(C(=O)COC(=O)c2ccc(Cl)c(N)c2)CC1 |
| InChI | InChI=1S/C15H18ClN3O4/c1-10(20)18-4-6-19(7-5-18)14(21)9-23-15(22)11-2-3-12(16)13(17)8-11/h2-3,8H,4-7,9,17H2,1H3 |
| InChIKey | QFBPLRJVHYPNMX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|