C17H18ClN5O3 — CID 9078959
[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] 3-amino-4-chlorobenzoate (PubChem CID 9078959) has the molecular formula C17H18ClN5O3 and a molecular weight of 375.82 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 9078959 |
| Molecular Formula | C17H18ClN5O3 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCC(=O)N2CCN(c3ncccn3)CC2)ccc1Cl |
| InChI | InChI=1S/C17H18ClN5O3/c18-13-3-2-12(10-14(13)19)16(25)26-11-15(24)22-6-8-23(9-7-22)17-20-4-1-5-21-17/h1-5,10H,6-9,11,19H2 |
| InChIKey | AGQDFEZCSRTEET-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|