C16H15Cl2N5O3 — CID 9231016
[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 9231016) has the molecular formula C16H15Cl2N5O3 and a molecular weight of 396.23 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 9231016 |
| Molecular Formula | C16H15Cl2N5O3 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(c2ncccn2)CC1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2N5O3/c17-12-8-11(9-21-14(12)18)15(25)26-10-13(24)22-4-6-23(7-5-22)16-19-2-1-3-20-16/h1-3,8-9H,4-7,10H2 |
| InChIKey | LZIZOSBPHJBHMF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|