C17H15Cl2N3O4S — CID 46814013
[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 46814013) has the molecular formula C17H15Cl2N3O4S and a molecular weight of 428.30 g/mol. Its IUPAC name is [2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 46814013 |
| Molecular Formula | C17H15Cl2N3O4S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | [2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(C(=O)c2cccs2)CC1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N3O4S/c18-12-8-11(9-20-15(12)19)17(25)26-10-14(23)21-3-5-22(6-4-21)16(24)13-2-1-7-27-13/h1-2,7-9H,3-6,10H2 |
| InChIKey | MQMNDFNRYDXQGR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|