C16H16N2O5S — CID 2355144
[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 2355144) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2355144 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(C(=O)c2ccco2)CC1)c1cccs1 |
| InChI | InChI=1S/C16H16N2O5S/c19-14(11-23-16(21)13-4-2-10-24-13)17-5-7-18(8-6-17)15(20)12-3-1-9-22-12/h1-4,9-10H,5-8,11H2 |
| InChIKey | JAJLWHWBRKTIPM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |