C12H15NO3S — CID 2356154
(2-oxo-2-piperidin-1-ylethyl) thiophene-2-carboxylate (PubChem CID 2356154) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) thiophene-2-carboxylate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2356154 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) thiophene-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCCCC1)c1cccs1 |
| InChI | InChI=1S/C12H15NO3S/c14-11(13-6-2-1-3-7-13)9-16-12(15)10-5-4-8-17-10/h4-5,8H,1-3,6-7,9H2 |
| InChIKey | NGCREZMXOHAVIC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |