C17H17FN2O5S2 — CID 9199359
[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 9199359) has the molecular formula C17H17FN2O5S2 and a molecular weight of 412.46 g/mol. Its IUPAC name is [2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 9199359 |
| Molecular Formula | C17H17FN2O5S2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | [2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | O=C(OCC(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1)c1cccs1 |
| InChI | InChI=1S/C17H17FN2O5S2/c18-13-3-1-4-14(11-13)27(23,24)20-8-6-19(7-9-20)16(21)12-25-17(22)15-5-2-10-26-15/h1-5,10-11H,6-9,12H2 |
| InChIKey | BAXUCSNVCZWYNW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |