C15H21FN2O3S — CID 78781800
1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 78781800) has the molecular formula C15H21FN2O3S and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 78781800 |
| Molecular Formula | C15H21FN2O3S |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H21FN2O3S/c1-2-3-7-15(19)17-8-10-18(11-9-17)22(20,21)14-6-4-5-13(16)12-14/h4-6,12H,2-3,7-11H2,1H3 |
| InChIKey | INCNZBHYTZLFOJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |