C15H20F2N2O3S — CID 78780026
1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]pentan-1-one (PubChem CID 78780026) has the molecular formula C15H20F2N2O3S and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]pentan-1-one.
| Compound Name | 1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 78780026 |
| Molecular Formula | C15H20F2N2O3S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H20F2N2O3S/c1-2-3-4-15(20)18-7-9-19(10-8-18)23(21,22)12-5-6-13(16)14(17)11-12/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | RJVKBEOHPCSJDE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |